C25H36O6 — CID 71503412
5-hydroxy-4-[1-(2-hydroxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexen-1-yl)-3-methylbutyl]-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione (PubChem CID 71503412) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is 5-hydroxy-4-[1-(2-hydroxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexen-1-yl)-3-methylbutyl]-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione.
| Compound Name | 5-hydroxy-4-[1-(2-hydroxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexen-1-yl)-3-methylbutyl]-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 71503412 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 5-hydroxy-4-[1-(2-hydroxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexen-1-yl)-3-methylbutyl]-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
| SMILES | CC(C)CC(C1=C(O)C(C)(C)C(=O)C(C)(C)C1=O)C1=C(O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C25H36O6/c1-12(2)11-13(14-16(26)22(3,4)20(30)23(5,6)17(14)27)15-18(28)24(7,8)21(31)25(9,10)19(15)29/h12-13,26,28H,11H2,1-10H3 |
| InChIKey | DTGVHLBCMZQKBB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|