C15H20O5 — CID 609575
2-(ethoxymethyl)-2-(2-hydroxy-6-oxocyclohexen-1-yl)cyclohexane-1,3-dione (PubChem CID 609575) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-(ethoxymethyl)-2-(2-hydroxy-6-oxocyclohexen-1-yl)cyclohexane-1,3-dione.
| Compound Name | 2-(ethoxymethyl)-2-(2-hydroxy-6-oxocyclohexen-1-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 609575 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-(ethoxymethyl)-2-(2-hydroxy-6-oxocyclohexen-1-yl)cyclohexane-1,3-dione |
| SMILES | CCOCC1(C2=C(O)CCCC2=O)C(=O)CCCC1=O |
| InChI | InChI=1S/C15H20O5/c1-2-20-9-15(12(18)7-4-8-13(15)19)14-10(16)5-3-6-11(14)17/h16H,2-9H2,1H3 |
| InChIKey | IBQRPJZVUYVYFR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|