C13H21N5O2 — CID 60964449
6-amino-1-ethyl-5-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)pyrimidine-2,4-dione (PubChem CID 60964449) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 6-amino-1-ethyl-5-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-ethyl-5-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60964449 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 6-amino-1-ethyl-5-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)pyrimidine-2,4-dione |
| SMILES | CCn1c(N)c(NC2CCN3CCCC23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N5O2/c1-2-18-11(14)10(12(19)16-13(18)20)15-8-5-7-17-6-3-4-9(8)17/h8-9,15H,2-7,14H2,1H3,(H,16,19,20) |
| InChIKey | RXKKOOFJCRWKGL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |