C16H28N6O2 — CID 142165013
2-[5-(dimethylamino)hexyl]-4-methyl-5a,6,7,8-tetrahydro-5H-purino[7,8-a]imidazole-1,3-dione (PubChem CID 142165013) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[5-(dimethylamino)hexyl]-4-methyl-5a,6,7,8-tetrahydro-5H-purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-[5-(dimethylamino)hexyl]-4-methyl-5a,6,7,8-tetrahydro-5H-purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 142165013 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2-[5-(dimethylamino)hexyl]-4-methyl-5a,6,7,8-tetrahydro-5H-purino[7,8-a]imidazole-1,3-dione |
| SMILES | CC(CCCCn1c(=O)c2c(n(C)c1=O)NC1NCCN21)N(C)C |
| InChI | InChI=1S/C16H28N6O2/c1-11(19(2)3)7-5-6-9-22-14(23)12-13(20(4)16(22)24)18-15-17-8-10-21(12)15/h11,15,17-18H,5-10H2,1-4H3 |
| InChIKey | IKLMJLYVNWIJMJ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|