About 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine
6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine (PubChem CID 60965780) has the molecular formula C14H10INO5
and a molecular weight of 399.14 g/mol. Its IUPAC name is 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 60965780 |
| Molecular Formula | C14H10INO5 |
| Molecular Weight | 399.14 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine |
| SMILES | O=[N+]([O-])c1cc2c(cc1Oc1ccccc1I)OCCO2 |
| InChI | InChI=1S/C14H10INO5/c15-9-3-1-2-4-11(9)21-12-8-14-13(19-5-6-20-14)7-10(12)16(17)18/h1-4,7-8H,5-6H2 |
| InChIKey | ZYFHZGTTWOSATL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.14 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine (CID 60965780) is 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine is O=[N+]([O-])c1cc2c(cc1Oc1ccccc1I)OCCO2.
What is the InChIKey of 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine?
The InChIKey is ZYFHZGTTWOSATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10INO5/c15-9-3-1-2-4-11(9)21-12-8-14-13(19-5-6-20-14)7-10(12)16(17)18/h1-4,7-8H,5-6H2.
What are the key properties of 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine?
6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine has a molecular weight of 399.14 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-iodophenoxy)-7-nitro-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 60965780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).