C14H14N2S2 — CID 6096778
N-(2-phenylethyl)-2-sulfanylidene-1H-pyridine-3-carbothioamide (PubChem CID 6096778) has the molecular formula C14H14N2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-sulfanylidene-1H-pyridine-3-carbothioamide.
| Compound Name | N-(2-phenylethyl)-2-sulfanylidene-1H-pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 6096778 |
| Molecular Formula | C14H14N2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | N-(2-phenylethyl)-2-sulfanylidene-1H-pyridine-3-carbothioamide |
| SMILES | S=C(NCCc1ccccc1)c1ccc[nH]c1=S |
| InChI | InChI=1S/C14H14N2S2/c17-13-12(7-4-9-15-13)14(18)16-10-8-11-5-2-1-3-6-11/h1-7,9H,8,10H2,(H,15,17)(H,16,18) |
| InChIKey | SMBQXOJWABXQBE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|