C13H14ClN3S2 — CID 45260909
N-(2-pyridin-2-ylethyl)-2-sulfanylidene-1H-pyridine-3-carbothioamide;hydrochloride (PubChem CID 45260909) has the molecular formula C13H14ClN3S2 and a molecular weight of 311.86 g/mol. Its IUPAC name is N-(2-pyridin-2-ylethyl)-2-sulfanylidene-1H-pyridine-3-carbothioamide;hydrochloride.
| Compound Name | N-(2-pyridin-2-ylethyl)-2-sulfanylidene-1H-pyridine-3-carbothioamide;hydrochloride |
|---|---|
| PubChem CID | 45260909 |
| Molecular Formula | C13H14ClN3S2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | N-(2-pyridin-2-ylethyl)-2-sulfanylidene-1H-pyridine-3-carbothioamide;hydrochloride |
| SMILES | Cl.S=C(NCCc1ccccn1)c1ccc[nH]c1=S |
| InChI | InChI=1S/C13H13N3S2.ClH/c17-12-11(5-3-8-15-12)13(18)16-9-6-10-4-1-2-7-14-10;/h1-5,7-8H,6,9H2,(H,15,17)(H,16,18);1H |
| InChIKey | MHXPWZDPCOXTHK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|