C14H20N2 — CID 60974611
2-(2-methylpyrrolidin-1-yl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 60974611) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(2-methylpyrrolidin-1-yl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-(2-methylpyrrolidin-1-yl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 60974611 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(2-methylpyrrolidin-1-yl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC1CCCN1C1Cc2ccccc2C1N |
| InChI | InChI=1S/C14H20N2/c1-10-5-4-8-16(10)13-9-11-6-2-3-7-12(11)14(13)15/h2-3,6-7,10,13-14H,4-5,8-9,15H2,1H3 |
| InChIKey | XYVQXPDBDMQKGQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |