C13H18N2 — CID 54082330
(11S,11aS)-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine (PubChem CID 54082330) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (11S,11aS)-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine.
| Compound Name | (11S,11aS)-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine |
|---|---|
| PubChem CID | 54082330 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (11S,11aS)-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine |
| SMILES | N[C@H]1c2ccccc2CN2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H18N2/c14-13-11-6-2-1-5-10(11)9-15-8-4-3-7-12(13)15/h1-2,5-6,12-13H,3-4,7-9,14H2/t12-,13-/m0/s1 |
| InChIKey | MNZDRSNXKGBWHJ-STQMWFEESA-N |
| XLogP | 2.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |