C14H20N2 — CID 12967038
(11R,11aS)-N-methyl-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine (PubChem CID 12967038) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (11R,11aS)-N-methyl-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine.
| Compound Name | (11R,11aS)-N-methyl-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine |
|---|---|
| PubChem CID | 12967038 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (11R,11aS)-N-methyl-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-11-amine |
| SMILES | CN[C@@H]1c2ccccc2CN2CCCC[C@@H]12 |
| InChI | InChI=1S/C14H20N2/c1-15-14-12-7-3-2-6-11(12)10-16-9-5-4-8-13(14)16/h2-3,6-7,13-15H,4-5,8-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | CJKKCGXOMQKQQB-UONOGXRCSA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |