C11H8ClN3S — CID 60978144
5-(4-chloro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole (PubChem CID 60978144) has the molecular formula C11H8ClN3S and a molecular weight of 249.73 g/mol. Its IUPAC name is 5-(4-chloro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole.
| Compound Name | 5-(4-chloro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 60978144 |
| Molecular Formula | C11H8ClN3S |
| Molecular Weight | 249.73 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 5-(4-chloro-1H-benzimidazol-2-yl)-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1-c1nc2c(Cl)cccc2[nH]1 |
| InChI | InChI=1S/C11H8ClN3S/c1-6-10(16-5-13-6)11-14-8-4-2-3-7(12)9(8)15-11/h2-5H,1H3,(H,14,15) |
| InChIKey | RYAJFXIYBKLYEP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |