C9H7N5S — CID 114402555
4-methyl-5-(7H-purin-8-yl)-1,3-thiazole (PubChem CID 114402555) has the molecular formula C9H7N5S and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-methyl-5-(7H-purin-8-yl)-1,3-thiazole.
| Compound Name | 4-methyl-5-(7H-purin-8-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 114402555 |
| Molecular Formula | C9H7N5S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 4-methyl-5-(7H-purin-8-yl)-1,3-thiazole |
| SMILES | Cc1ncsc1-c1nc2ncncc2[nH]1 |
| InChI | InChI=1S/C9H7N5S/c1-5-7(15-4-12-5)9-13-6-2-10-3-11-8(6)14-9/h2-4H,1H3,(H,10,11,13,14) |
| InChIKey | IDEQLVGBWNIKTF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |