C10H10N6 — CID 136989215
8-(2,5-dimethylpyrazol-3-yl)-7H-purine (PubChem CID 136989215) has the molecular formula C10H10N6 and a molecular weight of 214.23 g/mol. Its IUPAC name is 8-(2,5-dimethylpyrazol-3-yl)-7H-purine.
| Compound Name | 8-(2,5-dimethylpyrazol-3-yl)-7H-purine |
|---|---|
| PubChem CID | 136989215 |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 8-(2,5-dimethylpyrazol-3-yl)-7H-purine |
| SMILES | Cc1cc(-c2nc3ncncc3[nH]2)n(C)n1 |
| InChI | InChI=1S/C10H10N6/c1-6-3-8(16(2)15-6)10-13-7-4-11-5-12-9(7)14-10/h3-5H,1-2H3,(H,11,12,13,14) |
| InChIKey | TYCYKCSOMNONST-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |