C13H12N2S — CID 60978374
6-methyl-2-(thiophen-2-ylmethyl)-1H-benzimidazole (PubChem CID 60978374) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 6-methyl-2-(thiophen-2-ylmethyl)-1H-benzimidazole.
| Compound Name | 6-methyl-2-(thiophen-2-ylmethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 60978374 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 6-methyl-2-(thiophen-2-ylmethyl)-1H-benzimidazole |
| SMILES | Cc1ccc2nc(Cc3cccs3)[nH]c2c1 |
| InChI | InChI=1S/C13H12N2S/c1-9-4-5-11-12(7-9)15-13(14-11)8-10-3-2-6-16-10/h2-7H,8H2,1H3,(H,14,15) |
| InChIKey | UEBTUULCRBZHHH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |