C10H14N4 — CID 60978477
N-(1H-1,2,4-triazol-5-ylmethyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 60978477) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 60978477 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | C1=CC2C(C1)CC2NCc1ncn[nH]1 |
| InChI | InChI=1S/C10H14N4/c1-2-7-4-9(8(7)3-1)11-5-10-12-6-13-14-10/h1,3,6-9,11H,2,4-5H2,(H,12,13,14) |
| InChIKey | RITARJBCJLEIKI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|