C10H18N2O3S2 — CID 60985801
N,4-dimethyl-2-oxo-N-pentan-2-yl-3H-1,3-thiazole-5-sulfonamide (PubChem CID 60985801) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N,4-dimethyl-2-oxo-N-pentan-2-yl-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | N,4-dimethyl-2-oxo-N-pentan-2-yl-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 60985801 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N,4-dimethyl-2-oxo-N-pentan-2-yl-3H-1,3-thiazole-5-sulfonamide |
| SMILES | CCCC(C)N(C)S(=O)(=O)c1sc(=O)[nH]c1C |
| InChI | InChI=1S/C10H18N2O3S2/c1-5-6-7(2)12(4)17(14,15)9-8(3)11-10(13)16-9/h7H,5-6H2,1-4H3,(H,11,13) |
| InChIKey | NEZKTKAYHPIDFT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |