methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate

C17H16BrNO2 — CID 60993146

IUPACmethyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate
SMILESCOC(=O)C1(Nc2cccc(Br)c2)Cc2ccccc2C1
InChIInChI=1S/C17H16BrNO2/c1-21-16(20)17(19-15-8-4-7-14(18)9-15)10-12-5-2-3-6-13(12)11-17/h2-9,19H,10-11H2,1H3
InChIKeyYWQPUBJFSOBURK-UHFFFAOYSA-N
MW346.22 g/mol
LogP3.57
Rot. Bonds3

About methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate

methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate (PubChem CID 60993146) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate.

Molecular Properties

Compound Namemethyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate
PubChem CID60993146
Molecular FormulaC17H16BrNO2
Molecular Weight346.22 g/mol
Exact Mass345.04
IUPAC Namemethyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate
SMILESCOC(=O)C1(Nc2cccc(Br)c2)Cc2ccccc2C1
InChIInChI=1S/C17H16BrNO2/c1-21-16(20)17(19-15-8-4-7-14(18)9-15)10-12-5-2-3-6-13(12)11-17/h2-9,19H,10-11H2,1H3
InChIKeyYWQPUBJFSOBURK-UHFFFAOYSA-N
XLogP3.57
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.22
LogP ≤ 53.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate?
The IUPAC name of methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate (CID 60993146) is methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate.
What is the SMILES notation for methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate?
The canonical SMILES for methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate is COC(=O)C1(Nc2cccc(Br)c2)Cc2ccccc2C1.
What is the InChIKey of methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate?
The InChIKey is YWQPUBJFSOBURK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrNO2/c1-21-16(20)17(19-15-8-4-7-14(18)9-15)10-12-5-2-3-6-13(12)11-17/h2-9,19H,10-11H2,1H3.
What are the key properties of methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate?
methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate has a molecular weight of 346.22 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-bromoanilino)-1,3-dihydroindene-2-carboxylate is sourced from PubChem (CID 60993146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).