C12H14Cl2N2O — CID 60995676
2-(cyclopropylmethylamino)-2-(2,4-dichlorophenyl)acetamide (PubChem CID 60995676) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-(cyclopropylmethylamino)-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 60995676 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-(cyclopropylmethylamino)-2-(2,4-dichlorophenyl)acetamide |
| SMILES | NC(=O)C(NCC1CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O/c13-8-3-4-9(10(14)5-8)11(12(15)17)16-6-7-1-2-7/h3-5,7,11,16H,1-2,6H2,(H2,15,17) |
| InChIKey | FVNJFSAXRIJYQT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |