C14H14N4O2 — CID 61000886
4-[(E)-3-oxo-3-(1H-pyrazol-4-ylmethylamino)prop-1-enyl]benzamide (PubChem CID 61000886) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-[(E)-3-oxo-3-(1H-pyrazol-4-ylmethylamino)prop-1-enyl]benzamide.
| Compound Name | 4-[(E)-3-oxo-3-(1H-pyrazol-4-ylmethylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 61000886 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-[(E)-3-oxo-3-(1H-pyrazol-4-ylmethylamino)prop-1-enyl]benzamide |
| SMILES | NC(=O)c1ccc(/C=C/C(=O)NCc2cn[nH]c2)cc1 |
| InChI | InChI=1S/C14H14N4O2/c15-14(20)12-4-1-10(2-5-12)3-6-13(19)16-7-11-8-17-18-9-11/h1-6,8-9H,7H2,(H2,15,20)(H,16,19)(H,17,18)/b6-3+ |
| InChIKey | BUCSWTFXVDFKLT-ZZXKWVIFSA-N |
| XLogP | 0.84 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|