C13H11Cl2N3O — CID 54896919
(E)-3-(2,4-dichlorophenyl)-N-(1H-pyrazol-4-ylmethyl)prop-2-enamide (PubChem CID 54896919) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(1H-pyrazol-4-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(1H-pyrazol-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 54896919 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(1H-pyrazol-4-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NCc1cn[nH]c1 |
| InChI | InChI=1S/C13H11Cl2N3O/c14-11-3-1-10(12(15)5-11)2-4-13(19)16-6-9-7-17-18-8-9/h1-5,7-8H,6H2,(H,16,19)(H,17,18)/b4-2+ |
| InChIKey | DIJBCIKVDNFCOD-DUXPYHPUSA-N |
| XLogP | 3.05 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|