C12H15NO3 — CID 61003821
2-but-3-enoxy-4,6-dimethylpyridine-3-carboxylic acid (PubChem CID 61003821) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-but-3-enoxy-4,6-dimethylpyridine-3-carboxylic acid.
| Compound Name | 2-but-3-enoxy-4,6-dimethylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61003821 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-but-3-enoxy-4,6-dimethylpyridine-3-carboxylic acid |
| SMILES | C=CCCOc1nc(C)cc(C)c1C(=O)O |
| InChI | InChI=1S/C12H15NO3/c1-4-5-6-16-11-10(12(14)15)8(2)7-9(3)13-11/h4,7H,1,5-6H2,2-3H3,(H,14,15) |
| InChIKey | BYIUZGKLWLPGIG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|