C11H15NO3S — CID 65364374
2-(ethoxymethylsulfanyl)-4,6-dimethylpyridine-3-carboxylic acid (PubChem CID 65364374) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-(ethoxymethylsulfanyl)-4,6-dimethylpyridine-3-carboxylic acid.
| Compound Name | 2-(ethoxymethylsulfanyl)-4,6-dimethylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 65364374 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-(ethoxymethylsulfanyl)-4,6-dimethylpyridine-3-carboxylic acid |
| SMILES | CCOCSc1nc(C)cc(C)c1C(=O)O |
| InChI | InChI=1S/C11H15NO3S/c1-4-15-6-16-10-9(11(13)14)7(2)5-8(3)12-10/h5H,4,6H2,1-3H3,(H,13,14) |
| InChIKey | DOMITIXXENOILD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|