C11H14FNO2S — CID 81105842
2-(3-fluoropropylsulfanyl)-4,6-dimethylpyridine-3-carboxylic acid (PubChem CID 81105842) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-(3-fluoropropylsulfanyl)-4,6-dimethylpyridine-3-carboxylic acid.
| Compound Name | 2-(3-fluoropropylsulfanyl)-4,6-dimethylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81105842 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-(3-fluoropropylsulfanyl)-4,6-dimethylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(SCCCF)n1 |
| InChI | InChI=1S/C11H14FNO2S/c1-7-6-8(2)13-10(9(7)11(14)15)16-5-3-4-12/h6H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | KTUQCGRPQDMTBK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|