C16H17NO2S2 — CID 61359522
4,6-dimethyl-2-(2-phenylsulfanylethylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 61359522) has the molecular formula C16H17NO2S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4,6-dimethyl-2-(2-phenylsulfanylethylsulfanyl)pyridine-3-carboxylic acid.
| Compound Name | 4,6-dimethyl-2-(2-phenylsulfanylethylsulfanyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61359522 |
| Molecular Formula | C16H17NO2S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4,6-dimethyl-2-(2-phenylsulfanylethylsulfanyl)pyridine-3-carboxylic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(SCCSc2ccccc2)n1 |
| InChI | InChI=1S/C16H17NO2S2/c1-11-10-12(2)17-15(14(11)16(18)19)21-9-8-20-13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3,(H,18,19) |
| InChIKey | OWIGGLXUSBSYST-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|