About 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid
3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid (PubChem CID 61009048) has the molecular formula C13H18ClN3O3
and a molecular weight of 299.76 g/mol. Its IUPAC name is 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid |
| PubChem CID | 61009048 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)/C=C/c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C13H18ClN3O3/c1-4-17(8-7-12(19)20)11(18)6-5-10-9(2)15-16(3)13(10)14/h5-6H,4,7-8H2,1-3H3,(H,19,20)/b6-5+ |
| InChIKey | MCBDLVYSDQWJSY-AATRIKPKSA-N |
| XLogP | 1.72 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid?
The IUPAC name of 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid (CID 61009048) is 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid.
What is the SMILES notation for 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid?
The canonical SMILES for 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid is CCN(CCC(=O)O)C(=O)/C=C/c1c(C)nn(C)c1Cl.
What is the InChIKey of 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid?
The InChIKey is MCBDLVYSDQWJSY-AATRIKPKSA-N. The full InChI is InChI=1S/C13H18ClN3O3/c1-4-17(8-7-12(19)20)11(18)6-5-10-9(2)15-16(3)13(10)14/h5-6H,4,7-8H2,1-3H3,(H,19,20)/b6-5+.
What are the key properties of 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid?
3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid has a molecular weight of 299.76 g/mol, XLogP of 1.72, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-ethylamino]propanoic acid is sourced from PubChem (CID 61009048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).