C11H19NO2S — CID 61020768
N-(3-methylsulfonylpropyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 61020768) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is N-(3-methylsulfonylpropyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(3-methylsulfonylpropyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 61020768 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-(3-methylsulfonylpropyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | CS(=O)(=O)CCCNC1CC2CC=CC21 |
| InChI | InChI=1S/C11H19NO2S/c1-15(13,14)7-3-6-12-11-8-9-4-2-5-10(9)11/h2,5,9-12H,3-4,6-8H2,1H3 |
| InChIKey | BJMQGBHHHXZHGO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|