About tetrachlorostannane;triphenylphosphane
tetrachlorostannane;triphenylphosphane (PubChem CID 6102135) has the molecular formula C18H15Cl4PSn
and a molecular weight of 522.82 g/mol. Its IUPAC name is tetrachlorostannane;triphenylphosphane.
Molecular Properties
| Compound Name | tetrachlorostannane;triphenylphosphane |
| PubChem CID | 6102135 |
| Molecular Formula | C18H15Cl4PSn |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 521.87 |
| IUPAC Name | tetrachlorostannane;triphenylphosphane |
| SMILES | Cl[Sn](Cl)(Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.4ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;/h1-15H;4*1H;/q;;;;;+4/p-4 |
| InChIKey | PJJSBZYLNGNKJA-UHFFFAOYSA-J |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrachlorostannane;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrachlorostannane;triphenylphosphane?
The IUPAC name of tetrachlorostannane;triphenylphosphane (CID 6102135) is tetrachlorostannane;triphenylphosphane.
What is the SMILES notation for tetrachlorostannane;triphenylphosphane?
The canonical SMILES for tetrachlorostannane;triphenylphosphane is Cl[Sn](Cl)(Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetrachlorostannane;triphenylphosphane?
The InChIKey is PJJSBZYLNGNKJA-UHFFFAOYSA-J. The full InChI is InChI=1S/C18H15P.4ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;/h1-15H;4*1H;/q;;;;;+4/p-4.
What are the key properties of tetrachlorostannane;triphenylphosphane?
tetrachlorostannane;triphenylphosphane has a molecular weight of 522.82 g/mol, XLogP of 5.82, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrachlorostannane;triphenylphosphane is sourced from PubChem (CID 6102135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).