C12H17NO3 — CID 61024491
1-(1,4-dioxan-2-ylmethyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 61024491) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 61024491 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C)n1CC1COCCO1 |
| InChI | InChI=1S/C12H17NO3/c1-9-5-11(7-14)10(2)13(9)6-12-8-15-3-4-16-12/h5,7,12H,3-4,6,8H2,1-2H3 |
| InChIKey | AOUAICQVZPGGCL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|