C12H17NOS — CID 80585438
2,5-dimethyl-1-(thiolan-2-ylmethyl)pyrrole-3-carbaldehyde (PubChem CID 80585438) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2,5-dimethyl-1-(thiolan-2-ylmethyl)pyrrole-3-carbaldehyde.
| Compound Name | 2,5-dimethyl-1-(thiolan-2-ylmethyl)pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 80585438 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2,5-dimethyl-1-(thiolan-2-ylmethyl)pyrrole-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C)n1CC1CCCS1 |
| InChI | InChI=1S/C12H17NOS/c1-9-6-11(8-14)10(2)13(9)7-12-4-3-5-15-12/h6,8,12H,3-5,7H2,1-2H3 |
| InChIKey | JCTXDKJPDJUXQP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|