C13H21NO — CID 103461869
1-(2,2-dimethylbutyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 103461869) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-(2,2-dimethylbutyl)-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-(2,2-dimethylbutyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 103461869 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-(2,2-dimethylbutyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | CCC(C)(C)Cn1c(C)cc(C=O)c1C |
| InChI | InChI=1S/C13H21NO/c1-6-13(4,5)9-14-10(2)7-12(8-15)11(14)3/h7-8H,6,9H2,1-5H3 |
| InChIKey | MAGCURDMCRAZTF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|