C12H19NO — CID 23008366
2,5-dimethyl-1-pentan-3-ylpyrrole-3-carbaldehyde (PubChem CID 23008366) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2,5-dimethyl-1-pentan-3-ylpyrrole-3-carbaldehyde.
| Compound Name | 2,5-dimethyl-1-pentan-3-ylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 23008366 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2,5-dimethyl-1-pentan-3-ylpyrrole-3-carbaldehyde |
| SMILES | CCC(CC)n1c(C)cc(C=O)c1C |
| InChI | InChI=1S/C12H19NO/c1-5-12(6-2)13-9(3)7-11(8-14)10(13)4/h7-8,12H,5-6H2,1-4H3 |
| InChIKey | KEGIMIOICKRZFE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|