About 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide
2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide (PubChem CID 61027966) has the molecular formula C15H19N3O3
and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide |
| PubChem CID | 61027966 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide |
| SMILES | CNc1ccc(OCC(=O)Nc2cc(C(C)C)no2)cc1 |
| InChI | InChI=1S/C15H19N3O3/c1-10(2)13-8-15(21-18-13)17-14(19)9-20-12-6-4-11(16-3)5-7-12/h4-8,10,16H,9H2,1-3H3,(H,17,19) |
| InChIKey | PNKHMNBDXWZSNW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The IUPAC name of 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide (CID 61027966) is 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide.
What is the SMILES notation for 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The canonical SMILES for 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide is CNc1ccc(OCC(=O)Nc2cc(C(C)C)no2)cc1.
What is the InChIKey of 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
The InChIKey is PNKHMNBDXWZSNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-10(2)13-8-15(21-18-13)17-14(19)9-20-12-6-4-11(16-3)5-7-12/h4-8,10,16H,9H2,1-3H3,(H,17,19).
What are the key properties of 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide?
2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide has a molecular weight of 289.33 g/mol, XLogP of 2.86, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(methylamino)phenoxy]-N-(3-propan-2-yl-1,2-oxazol-5-yl)acetamide is sourced from PubChem (CID 61027966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).