C14H23N3O3 — CID 61032488
methyl 3-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)-methylamino]propanoate (PubChem CID 61032488) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 3-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)-methylamino]propanoate.
| Compound Name | methyl 3-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)-methylamino]propanoate |
|---|---|
| PubChem CID | 61032488 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | methyl 3-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)-methylamino]propanoate |
| SMILES | CCn1nc(C(C)C)cc1C(=O)N(C)CCC(=O)OC |
| InChI | InChI=1S/C14H23N3O3/c1-6-17-12(9-11(15-17)10(2)3)14(19)16(4)8-7-13(18)20-5/h9-10H,6-8H2,1-5H3 |
| InChIKey | DJSYGBTXPDWKOP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |