C14H16N2O4 — CID 61034072
N-(2-amino-2-oxoethyl)-3-(4-hydroxybut-1-ynyl)-4-methoxybenzamide (PubChem CID 61034072) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-(4-hydroxybut-1-ynyl)-4-methoxybenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-(4-hydroxybut-1-ynyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 61034072 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-(4-hydroxybut-1-ynyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(N)=O)cc1C#CCCO |
| InChI | InChI=1S/C14H16N2O4/c1-20-12-6-5-11(14(19)16-9-13(15)18)8-10(12)4-2-3-7-17/h5-6,8,17H,3,7,9H2,1H3,(H2,15,18)(H,16,19) |
| InChIKey | MAXVHMOABRVCKR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|