C13H17N3O2 — CID 83023217
3-(3-aminoprop-1-ynyl)-4-methoxy-N',N'-dimethylbenzohydrazide (PubChem CID 83023217) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-4-methoxy-N',N'-dimethylbenzohydrazide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-4-methoxy-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 83023217 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-4-methoxy-N',N'-dimethylbenzohydrazide |
| SMILES | COc1ccc(C(=O)NN(C)C)cc1C#CCN |
| InChI | InChI=1S/C13H17N3O2/c1-16(2)15-13(17)11-6-7-12(18-3)10(9-11)5-4-8-14/h6-7,9H,8,14H2,1-3H3,(H,15,17) |
| InChIKey | YIXHBVLJTWBKBL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|