C16H16N2O2S — CID 63244337
3-(3-aminoprop-1-ynyl)-4-methoxy-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 63244337) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-4-methoxy-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-4-methoxy-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 63244337 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-4-methoxy-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)NCc2ccsc2)cc1C#CCN |
| InChI | InChI=1S/C16H16N2O2S/c1-20-15-5-4-14(9-13(15)3-2-7-17)16(19)18-10-12-6-8-21-11-12/h4-6,8-9,11H,7,10,17H2,1H3,(H,18,19) |
| InChIKey | FAMWJNZNIPCKMZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|