C14H19ClN2O2S — CID 61038242
(E)-N-(2-aminocyclohexyl)-2-(4-chlorophenyl)ethenesulfonamide (PubChem CID 61038242) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is (E)-N-(2-aminocyclohexyl)-2-(4-chlorophenyl)ethenesulfonamide.
| Compound Name | (E)-N-(2-aminocyclohexyl)-2-(4-chlorophenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 61038242 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (E)-N-(2-aminocyclohexyl)-2-(4-chlorophenyl)ethenesulfonamide |
| SMILES | NC1CCCCC1NS(=O)(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O2S/c15-12-7-5-11(6-8-12)9-10-20(18,19)17-14-4-2-1-3-13(14)16/h5-10,13-14,17H,1-4,16H2/b10-9+ |
| InChIKey | PXALBBDUFBAEAH-MDZDMXLPSA-N |
| XLogP | 2.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |