C15H22N2O — CID 61048443
[2-(1,4-diazepan-1-yl)-1,3-dihydroinden-2-yl]methanol (PubChem CID 61048443) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is [2-(1,4-diazepan-1-yl)-1,3-dihydroinden-2-yl]methanol.
| Compound Name | [2-(1,4-diazepan-1-yl)-1,3-dihydroinden-2-yl]methanol |
|---|---|
| PubChem CID | 61048443 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [2-(1,4-diazepan-1-yl)-1,3-dihydroinden-2-yl]methanol |
| SMILES | OCC1(N2CCCNCC2)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H22N2O/c18-12-15(17-8-3-6-16-7-9-17)10-13-4-1-2-5-14(13)11-15/h1-2,4-5,16,18H,3,6-12H2 |
| InChIKey | ZRCPOPUCRYVSOH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |