C10H20N2O3S — CID 63166481
[3-(1,4-diazepan-1-yl)-1,1-dioxothiolan-3-yl]methanol (PubChem CID 63166481) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is [3-(1,4-diazepan-1-yl)-1,1-dioxothiolan-3-yl]methanol.
| Compound Name | [3-(1,4-diazepan-1-yl)-1,1-dioxothiolan-3-yl]methanol |
|---|---|
| PubChem CID | 63166481 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [3-(1,4-diazepan-1-yl)-1,1-dioxothiolan-3-yl]methanol |
| SMILES | O=S1(=O)CCC(CO)(N2CCCNCC2)C1 |
| InChI | InChI=1S/C10H20N2O3S/c13-8-10(2-7-16(14,15)9-10)12-5-1-3-11-4-6-12/h11,13H,1-9H2 |
| InChIKey | GNNOJYFMBVEKNF-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |