C9H18N2O3S — CID 63165904
(1,1-dioxo-3-piperazin-1-ylthiolan-3-yl)methanol (PubChem CID 63165904) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is (1,1-dioxo-3-piperazin-1-ylthiolan-3-yl)methanol.
| Compound Name | (1,1-dioxo-3-piperazin-1-ylthiolan-3-yl)methanol |
|---|---|
| PubChem CID | 63165904 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (1,1-dioxo-3-piperazin-1-ylthiolan-3-yl)methanol |
| SMILES | O=S1(=O)CCC(CO)(N2CCNCC2)C1 |
| InChI | InChI=1S/C9H18N2O3S/c12-7-9(1-6-15(13,14)8-9)11-4-2-10-3-5-11/h10,12H,1-8H2 |
| InChIKey | OOIATHJVWFCDFX-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |