C16H24FNO — CID 61049933
[1-(2-fluoroanilino)-3,3,5-trimethylcyclohexyl]methanol (PubChem CID 61049933) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is [1-(2-fluoroanilino)-3,3,5-trimethylcyclohexyl]methanol.
| Compound Name | [1-(2-fluoroanilino)-3,3,5-trimethylcyclohexyl]methanol |
|---|---|
| PubChem CID | 61049933 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | [1-(2-fluoroanilino)-3,3,5-trimethylcyclohexyl]methanol |
| SMILES | CC1CC(C)(C)CC(CO)(Nc2ccccc2F)C1 |
| InChI | InChI=1S/C16H24FNO/c1-12-8-15(2,3)10-16(9-12,11-19)18-14-7-5-4-6-13(14)17/h4-7,12,18-19H,8-11H2,1-3H3 |
| InChIKey | ZLQOSPKKXBXZID-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |