C21H28N2 — CID 142641903
3,3,5-trimethyl-1-N,1-N'-diphenylcyclohexane-1,1-diamine (PubChem CID 142641903) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 3,3,5-trimethyl-1-N,1-N'-diphenylcyclohexane-1,1-diamine.
| Compound Name | 3,3,5-trimethyl-1-N,1-N'-diphenylcyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 142641903 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 3,3,5-trimethyl-1-N,1-N'-diphenylcyclohexane-1,1-diamine |
| SMILES | CC1CC(C)(C)CC(Nc2ccccc2)(Nc2ccccc2)C1 |
| InChI | InChI=1S/C21H28N2/c1-17-14-20(2,3)16-21(15-17,22-18-10-6-4-7-11-18)23-19-12-8-5-9-13-19/h4-13,17,22-23H,14-16H2,1-3H3 |
| InChIKey | KEXVPEHAPMITJA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|