C9H14ClN3O3S2 — CID 61050864
2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-propylpropanamide (PubChem CID 61050864) has the molecular formula C9H14ClN3O3S2 and a molecular weight of 311.82 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-propylpropanamide.
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 61050864 |
| Molecular Formula | C9H14ClN3O3S2 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C9H14ClN3O3S2/c1-3-4-11-8(14)6(2)13-18(15,16)7-5-12-9(10)17-7/h5-6,13H,3-4H2,1-2H3,(H,11,14) |
| InChIKey | ZFVNMVPAMVRYFM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |