C13H22N4 — CID 6105127
N"-[(E)-(4-methyl-4-phenylpentan-2-ylidene)amino]methanetriamine (PubChem CID 6105127) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N"-[(E)-(4-methyl-4-phenylpentan-2-ylidene)amino]methanetriamine.
| Compound Name | N"-[(E)-(4-methyl-4-phenylpentan-2-ylidene)amino]methanetriamine |
|---|---|
| PubChem CID | 6105127 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N"-[(E)-(4-methyl-4-phenylpentan-2-ylidene)amino]methanetriamine |
| SMILES | C/C(CC(C)(C)c1ccccc1)=N\NC(N)N |
| InChI | InChI=1S/C13H22N4/c1-10(16-17-12(14)15)9-13(2,3)11-7-5-4-6-8-11/h4-8,12,17H,9,14-15H2,1-3H3/b16-10+ |
| InChIKey | BEDYVWDCRYITEB-MHWRWJLKSA-N |
| XLogP | 1.52 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|