C13H20ClN3O3S — CID 61053074
2-[(2-chloro-4-pyridinyl)sulfonylamino]-N,N,4-trimethylpentanamide (PubChem CID 61053074) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-[(2-chloro-4-pyridinyl)sulfonylamino]-N,N,4-trimethylpentanamide.
| Compound Name | 2-[(2-chloro-4-pyridinyl)sulfonylamino]-N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 61053074 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[(2-chloro-4-pyridinyl)sulfonylamino]-N,N,4-trimethylpentanamide |
| SMILES | CC(C)CC(NS(=O)(=O)c1ccnc(Cl)c1)C(=O)N(C)C |
| InChI | InChI=1S/C13H20ClN3O3S/c1-9(2)7-11(13(18)17(3)4)16-21(19,20)10-5-6-15-12(14)8-10/h5-6,8-9,11,16H,7H2,1-4H3 |
| InChIKey | ZRCBNXJEMPNYEY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|