C10H14BrNO3S2 — CID 61060142
5-bromo-N-methyl-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 61060142) has the molecular formula C10H14BrNO3S2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-methyl-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61060142 |
| Molecular Formula | C10H14BrNO3S2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | 5-bromo-N-methyl-N-(oxolan-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CN(CC1CCCO1)S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H14BrNO3S2/c1-12(7-8-3-2-6-15-8)17(13,14)10-5-4-9(11)16-10/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | WYIQTPLRFLNUQV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |