C15H20BrNO3S — CID 61060372
1-[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]cycloheptane-1-carboxylic acid (PubChem CID 61060372) has the molecular formula C15H20BrNO3S and a molecular weight of 374.30 g/mol. Its IUPAC name is 1-[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 61060372 |
| Molecular Formula | C15H20BrNO3S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 1-[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]cycloheptane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCCCCC1)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C15H20BrNO3S/c16-11-7-12(21-10-11)9-17-13(18)8-15(14(19)20)5-3-1-2-4-6-15/h7,10H,1-6,8-9H2,(H,17,18)(H,19,20) |
| InChIKey | FBEUBBUCMASMQB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |