C13H13BrN2O3S2 — CID 61062884
2-[(3-bromothiophen-2-yl)sulfonylamino]-N,N-dimethylbenzamide (PubChem CID 61062884) has the molecular formula C13H13BrN2O3S2 and a molecular weight of 389.30 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)sulfonylamino]-N,N-dimethylbenzamide.
| Compound Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 61062884 |
| Molecular Formula | C13H13BrN2O3S2 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1NS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C13H13BrN2O3S2/c1-16(2)12(17)9-5-3-4-6-11(9)15-21(18,19)13-10(14)7-8-20-13/h3-8,15H,1-2H3 |
| InChIKey | ITSYSQHZZAFSBS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |