C15H23NO4 — CID 61073232
2-hydroxy-N-(2-methoxyethyl)-N-(3-methoxypropyl)-5-methylbenzamide (PubChem CID 61073232) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-hydroxy-N-(2-methoxyethyl)-N-(3-methoxypropyl)-5-methylbenzamide.
| Compound Name | 2-hydroxy-N-(2-methoxyethyl)-N-(3-methoxypropyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 61073232 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-hydroxy-N-(2-methoxyethyl)-N-(3-methoxypropyl)-5-methylbenzamide |
| SMILES | COCCCN(CCOC)C(=O)c1cc(C)ccc1O |
| InChI | InChI=1S/C15H23NO4/c1-12-5-6-14(17)13(11-12)15(18)16(8-10-20-3)7-4-9-19-2/h5-6,11,17H,4,7-10H2,1-3H3 |
| InChIKey | YAZBJNRHGSYNAJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|