C13H14N2O4S2 — CID 61074119
3,4-dimethyl-5-(1,3-thiazol-2-ylmethylsulfamoyl)benzoic acid (PubChem CID 61074119) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3,4-dimethyl-5-(1,3-thiazol-2-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 3,4-dimethyl-5-(1,3-thiazol-2-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 61074119 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3,4-dimethyl-5-(1,3-thiazol-2-ylmethylsulfamoyl)benzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)NCc2nccs2)c1C |
| InChI | InChI=1S/C13H14N2O4S2/c1-8-5-10(13(16)17)6-11(9(8)2)21(18,19)15-7-12-14-3-4-20-12/h3-6,15H,7H2,1-2H3,(H,16,17) |
| InChIKey | XEACAGBGHSBUJA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |